C27H49NO7 — CID 118016783
(Z)-13-[2-[2-butanoyloxyethyl(methyl)amino]acetyl]oxy-12-hydroxyoctadec-9-enoic acid (PubChem CID 118016783) has the molecular formula C27H49NO7 and a molecular weight of 499.69 g/mol. Its IUPAC name is (Z)-13-[2-[2-butanoyloxyethyl(methyl)amino]acetyl]oxy-12-hydroxyoctadec-9-enoic acid.
| Compound Name | (Z)-13-[2-[2-butanoyloxyethyl(methyl)amino]acetyl]oxy-12-hydroxyoctadec-9-enoic acid |
|---|---|
| PubChem CID | 118016783 |
| Molecular Formula | C27H49NO7 |
| Molecular Weight | 499.69 g/mol |
| Exact Mass | 499.35 |
| IUPAC Name | (Z)-13-[2-[2-butanoyloxyethyl(methyl)amino]acetyl]oxy-12-hydroxyoctadec-9-enoic acid |
| SMILES | CCCCCC(OC(=O)CN(C)CCOC(=O)CCC)C(O)C/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C27H49NO7/c1-4-6-13-18-24(35-27(33)22-28(3)20-21-34-26(32)16-5-2)23(29)17-14-11-9-7-8-10-12-15-19-25(30)31/h11,14,23-24,29H,4-10,12-13,15-22H2,1-3H3,(H,30,31)/b14-11- |
| InChIKey | IPKBHEJDRSQMMD-KAMYIIQDSA-N |
| XLogP | 4.88 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.69 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|