C25H28N4O3 — CID 118017985
tert-butyl 6-[4-(7-carbamoylindazol-2-yl)phenyl]-3-azabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 118017985) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is tert-butyl 6-[4-(7-carbamoylindazol-2-yl)phenyl]-3-azabicyclo[4.1.0]heptane-3-carboxylate.
| Compound Name | tert-butyl 6-[4-(7-carbamoylindazol-2-yl)phenyl]-3-azabicyclo[4.1.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 118017985 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | tert-butyl 6-[4-(7-carbamoylindazol-2-yl)phenyl]-3-azabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(c3ccc(-n4cc5cccc(C(N)=O)c5n4)cc3)CC2C1 |
| InChI | InChI=1S/C25H28N4O3/c1-24(2,3)32-23(31)28-12-11-25(13-18(25)15-28)17-7-9-19(10-8-17)29-14-16-5-4-6-20(22(26)30)21(16)27-29/h4-10,14,18H,11-13,15H2,1-3H3,(H2,26,30) |
| InChIKey | ZFAWSEJFEMBXDB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |