C30H21NO2S2 — CID 118026406
5-[5-[1-[4-(hydroxymethyl)phenyl]-2-phenylindol-3-yl]thiophen-2-yl]thiophene-2-carbaldehyde (PubChem CID 118026406) has the molecular formula C30H21NO2S2 and a molecular weight of 491.64 g/mol. Its IUPAC name is 5-[5-[1-[4-(hydroxymethyl)phenyl]-2-phenylindol-3-yl]thiophen-2-yl]thiophene-2-carbaldehyde.
| Compound Name | 5-[5-[1-[4-(hydroxymethyl)phenyl]-2-phenylindol-3-yl]thiophen-2-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 118026406 |
| Molecular Formula | C30H21NO2S2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | 5-[5-[1-[4-(hydroxymethyl)phenyl]-2-phenylindol-3-yl]thiophen-2-yl]thiophene-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2ccc(-c3c(-c4ccccc4)n(-c4ccc(CO)cc4)c4ccccc34)s2)s1 |
| InChI | InChI=1S/C30H21NO2S2/c32-18-20-10-12-22(13-11-20)31-25-9-5-4-8-24(25)29(30(31)21-6-2-1-3-7-21)28-17-16-27(35-28)26-15-14-23(19-33)34-26/h1-17,19,32H,18H2 |
| InChIKey | KVWMSQOTGRZQMM-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|