C18H28O6 — CID 118028658
[(1'S,5'R,6R)-5'-hydroxy-2,2,6-trimethylspiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,6'-cyclohex-3-ene]-1'-yl] 2,2-dimethylpropanoate (PubChem CID 118028658) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is [(1'S,5'R,6R)-5'-hydroxy-2,2,6-trimethylspiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,6'-cyclohex-3-ene]-1'-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1'S,5'R,6R)-5'-hydroxy-2,2,6-trimethylspiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,6'-cyclohex-3-ene]-1'-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 118028658 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | [(1'S,5'R,6R)-5'-hydroxy-2,2,6-trimethylspiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,6'-cyclohex-3-ene]-1'-yl] 2,2-dimethylpropanoate |
| SMILES | CC1C2OC(C)(C)OC2OC12[C@H](O)C=CC[C@@H]2OC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H28O6/c1-10-13-14(23-17(5,6)22-13)24-18(10)11(19)8-7-9-12(18)21-15(20)16(2,3)4/h7-8,10-14,19H,9H2,1-6H3/t10?,11-,12+,13?,14?,18?/m1/s1 |
| InChIKey | XZUZWBLVQVEKNX-AWYQWGJJSA-N |
| XLogP | 2.15 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|