C23H24N2O7 — CID 118028690
1-[(1S,6S,8R,9R,11S)-11-methoxy-2-oxo-7,10-dioxatricyclo[6.2.1.01,6]undec-3-en-9-yl]-5-methyl-3-(phenylmethoxymethyl)pyrimidine-2,4-dione (PubChem CID 118028690) has the molecular formula C23H24N2O7 and a molecular weight of 440.45 g/mol. Its IUPAC name is 1-[(1S,6S,8R,9R,11S)-11-methoxy-2-oxo-7,10-dioxatricyclo[6.2.1.01,6]undec-3-en-9-yl]-5-methyl-3-(phenylmethoxymethyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(1S,6S,8R,9R,11S)-11-methoxy-2-oxo-7,10-dioxatricyclo[6.2.1.01,6]undec-3-en-9-yl]-5-methyl-3-(phenylmethoxymethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118028690 |
| Molecular Formula | C23H24N2O7 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 1-[(1S,6S,8R,9R,11S)-11-methoxy-2-oxo-7,10-dioxatricyclo[6.2.1.01,6]undec-3-en-9-yl]-5-methyl-3-(phenylmethoxymethyl)pyrimidine-2,4-dione |
| SMILES | CO[C@H]1[C@H]2O[C@H]3CC=CC(=O)[C@]31O[C@H]2n1cc(C)c(=O)n(COCc2ccccc2)c1=O |
| InChI | InChI=1S/C23H24N2O7/c1-14-11-24(22(28)25(20(14)27)13-30-12-15-7-4-3-5-8-15)21-18-19(29-2)23(32-21)16(26)9-6-10-17(23)31-18/h3-9,11,17-19,21H,10,12-13H2,1-2H3/t17-,18+,19-,21+,23-/m0/s1 |
| InChIKey | YDXAXWNZNXUZMM-FFSTWTIQSA-N |
| XLogP | 1.07 |
| TPSA | 97.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |