C30H33N3O8 — CID 20707005
2-[2-[2-[3-methyl-5-[5-methyl-2,4-dioxo-3-(phenylmethoxymethyl)pyrimidin-1-yl]oxolan-2-yl]oxyethoxy]ethyl]isoindole-1,3-dione (PubChem CID 20707005) has the molecular formula C30H33N3O8 and a molecular weight of 563.61 g/mol. Its IUPAC name is 2-[2-[2-[3-methyl-5-[5-methyl-2,4-dioxo-3-(phenylmethoxymethyl)pyrimidin-1-yl]oxolan-2-yl]oxyethoxy]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[2-[3-methyl-5-[5-methyl-2,4-dioxo-3-(phenylmethoxymethyl)pyrimidin-1-yl]oxolan-2-yl]oxyethoxy]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 20707005 |
| Molecular Formula | C30H33N3O8 |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | 2-[2-[2-[3-methyl-5-[5-methyl-2,4-dioxo-3-(phenylmethoxymethyl)pyrimidin-1-yl]oxolan-2-yl]oxyethoxy]ethyl]isoindole-1,3-dione |
| SMILES | Cc1cn(C2CC(C)C(OCCOCCN3C(=O)c4ccccc4C3=O)O2)c(=O)n(COCc2ccccc2)c1=O |
| InChI | InChI=1S/C30H33N3O8/c1-20-16-25(32-17-21(2)26(34)33(30(32)37)19-39-18-22-8-4-3-5-9-22)41-29(20)40-15-14-38-13-12-31-27(35)23-10-6-7-11-24(23)28(31)36/h3-11,17,20,25,29H,12-16,18-19H2,1-2H3 |
| InChIKey | OZZRABASOADJES-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 118.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|