C22H27F3N4O7 — CID 59119800
N-[2-[(2R,3R,4R,5R)-5-(aminomethyl)-4-hydroxy-2-[5-methyl-2,4-dioxo-3-(phenylmethoxymethyl)pyrimidin-1-yl]oxolan-3-yl]oxyethyl]-2,2,2-trifluoroacetamide (PubChem CID 59119800) has the molecular formula C22H27F3N4O7 and a molecular weight of 516.47 g/mol. Its IUPAC name is N-[2-[(2R,3R,4R,5R)-5-(aminomethyl)-4-hydroxy-2-[5-methyl-2,4-dioxo-3-(phenylmethoxymethyl)pyrimidin-1-yl]oxolan-3-yl]oxyethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-[(2R,3R,4R,5R)-5-(aminomethyl)-4-hydroxy-2-[5-methyl-2,4-dioxo-3-(phenylmethoxymethyl)pyrimidin-1-yl]oxolan-3-yl]oxyethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 59119800 |
| Molecular Formula | C22H27F3N4O7 |
| Molecular Weight | 516.47 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | N-[2-[(2R,3R,4R,5R)-5-(aminomethyl)-4-hydroxy-2-[5-methyl-2,4-dioxo-3-(phenylmethoxymethyl)pyrimidin-1-yl]oxolan-3-yl]oxyethyl]-2,2,2-trifluoroacetamide |
| SMILES | Cc1cn([C@@H]2O[C@H](CN)[C@@H](O)[C@H]2OCCNC(=O)C(F)(F)F)c(=O)n(COCc2ccccc2)c1=O |
| InChI | InChI=1S/C22H27F3N4O7/c1-13-10-28(21(33)29(18(13)31)12-34-11-14-5-3-2-4-6-14)19-17(16(30)15(9-26)36-19)35-8-7-27-20(32)22(23,24)25/h2-6,10,15-17,19,30H,7-9,11-12,26H2,1H3,(H,27,32)/t15-,16-,17-,19-/m1/s1 |
| InChIKey | PNXOFABZLYJQKL-YWTNHNAXSA-N |
| XLogP | -0.23 |
| TPSA | 147.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.47 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|