C40H48N2O11 — CID 171482751
methyl 3-[3-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-(2-methoxyethoxy)oxolan-2-yl]-5-methyl-2,6-dioxopyrimidin-1-yl]-2,2-dimethylpropanoate (PubChem CID 171482751) has the molecular formula C40H48N2O11 and a molecular weight of 732.83 g/mol. Its IUPAC name is methyl 3-[3-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-(2-methoxyethoxy)oxolan-2-yl]-5-methyl-2,6-dioxopyrimidin-1-yl]-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[3-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-(2-methoxyethoxy)oxolan-2-yl]-5-methyl-2,6-dioxopyrimidin-1-yl]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 171482751 |
| Molecular Formula | C40H48N2O11 |
| Molecular Weight | 732.83 g/mol |
| Exact Mass | 732.33 |
| IUPAC Name | methyl 3-[3-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-(2-methoxyethoxy)oxolan-2-yl]-5-methyl-2,6-dioxopyrimidin-1-yl]-2,2-dimethylpropanoate |
| SMILES | COCCO[C@@H]1[C@H](O)[C@@H](COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)O[C@H]1n1cc(C)c(=O)n(CC(C)(C)C(=O)OC)c1=O |
| InChI | InChI=1S/C40H48N2O11/c1-26-23-41(38(46)42(35(26)44)25-39(2,3)37(45)50-7)36-34(51-22-21-47-4)33(43)32(53-36)24-52-40(27-11-9-8-10-12-27,28-13-17-30(48-5)18-14-28)29-15-19-31(49-6)20-16-29/h8-20,23,32-34,36,43H,21-22,24-25H2,1-7H3/t32-,33-,34-,36-/m1/s1 |
| InChIKey | DKKGQWUHWAZVTO-OXRFBFFUSA-N |
| XLogP | 3.83 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.83 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|