C33H36N2O9 — CID 169242708
3-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxy-4-(2-methoxyethoxy)oxolan-2-yl]-1H-pyrimidine-2,4-dione (PubChem CID 169242708) has the molecular formula C33H36N2O9 and a molecular weight of 604.66 g/mol. Its IUPAC name is 3-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxy-4-(2-methoxyethoxy)oxolan-2-yl]-1H-pyrimidine-2,4-dione.
| Compound Name | 3-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxy-4-(2-methoxyethoxy)oxolan-2-yl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 169242708 |
| Molecular Formula | C33H36N2O9 |
| Molecular Weight | 604.66 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | 3-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxy-4-(2-methoxyethoxy)oxolan-2-yl]-1H-pyrimidine-2,4-dione |
| SMILES | COCCO[C@H]1[C@@H](O)[C@H](n2c(=O)cc[nH]c2=O)O[C@@H]1COC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C33H36N2O9/c1-39-19-20-42-30-27(44-31(29(30)37)35-28(36)17-18-34-32(35)38)21-43-33(22-7-5-4-6-8-22,23-9-13-25(40-2)14-10-23)24-11-15-26(41-3)16-12-24/h4-18,27,29-31,37H,19-21H2,1-3H3,(H,34,38)/t27-,29-,30-,31-/m1/s1 |
| InChIKey | WEMRBGCLAMRDCI-PMFUCWTESA-N |
| XLogP | 2.85 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.66 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|