C37H43N3O10 — CID 175677390
2-[5-[(2S,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-(2-methoxyethoxy)oxolan-2-yl]-2,4-dioxopyrimidin-1-yl]-N-ethylacetamide (PubChem CID 175677390) has the molecular formula C37H43N3O10 and a molecular weight of 689.76 g/mol. Its IUPAC name is 2-[5-[(2S,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-(2-methoxyethoxy)oxolan-2-yl]-2,4-dioxopyrimidin-1-yl]-N-ethylacetamide.
| Compound Name | 2-[5-[(2S,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-(2-methoxyethoxy)oxolan-2-yl]-2,4-dioxopyrimidin-1-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 175677390 |
| Molecular Formula | C37H43N3O10 |
| Molecular Weight | 689.76 g/mol |
| Exact Mass | 689.29 |
| IUPAC Name | 2-[5-[(2S,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-(2-methoxyethoxy)oxolan-2-yl]-2,4-dioxopyrimidin-1-yl]-N-ethylacetamide |
| SMILES | CCNC(=O)Cn1cc([C@@H]2O[C@H](COC(c3ccccc3)(c3ccc(OC)cc3)c3ccc(OC)cc3)[C@@H](O)[C@H]2OCCOC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C37H43N3O10/c1-5-38-31(41)22-40-21-29(35(43)39-36(40)44)33-34(48-20-19-45-2)32(42)30(50-33)23-49-37(24-9-7-6-8-10-24,25-11-15-27(46-3)16-12-25)26-13-17-28(47-4)18-14-26/h6-18,21,30,32-34,42H,5,19-20,22-23H2,1-4H3,(H,38,41)(H,39,43,44)/t30-,32-,33+,34-/m1/s1 |
| InChIKey | BTADTOWTIAWVIS-SMEQTMGHSA-N |
| XLogP | 2.53 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.76 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|