C35H39FN4O8 — CID 144835512
9-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-(2-methoxyethoxy)oxolan-2-yl]-1-fluoro-2-methyl-7,8-dihydropurin-6-one (PubChem CID 144835512) has the molecular formula C35H39FN4O8 and a molecular weight of 662.72 g/mol. Its IUPAC name is 9-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-(2-methoxyethoxy)oxolan-2-yl]-1-fluoro-2-methyl-7,8-dihydropurin-6-one.
| Compound Name | 9-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-(2-methoxyethoxy)oxolan-2-yl]-1-fluoro-2-methyl-7,8-dihydropurin-6-one |
|---|---|
| PubChem CID | 144835512 |
| Molecular Formula | C35H39FN4O8 |
| Molecular Weight | 662.72 g/mol |
| Exact Mass | 662.28 |
| IUPAC Name | 9-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-(2-methoxyethoxy)oxolan-2-yl]-1-fluoro-2-methyl-7,8-dihydropurin-6-one |
| SMILES | COCCOC1C(O)C(COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)OC1N1CNc2c1nc(C)n(F)c2=O |
| InChI | InChI=1S/C35H39FN4O8/c1-22-38-32-29(33(42)40(22)36)37-21-39(32)34-31(46-19-18-43-2)30(41)28(48-34)20-47-35(23-8-6-5-7-9-23,24-10-14-26(44-3)15-11-24)25-12-16-27(45-4)17-13-25/h5-17,28,30-31,34,37,41H,18-21H2,1-4H3 |
| InChIKey | WJAZGVQXXMBYPK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 125.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.72 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|