C11H11IN4 — CID 118029133
6-(iodomethyl)-N-(pyridin-3-ylmethyl)pyrimidin-4-amine (PubChem CID 118029133) has the molecular formula C11H11IN4 and a molecular weight of 326.14 g/mol. Its IUPAC name is 6-(iodomethyl)-N-(pyridin-3-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-(iodomethyl)-N-(pyridin-3-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 118029133 |
| Molecular Formula | C11H11IN4 |
| Molecular Weight | 326.14 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | 6-(iodomethyl)-N-(pyridin-3-ylmethyl)pyrimidin-4-amine |
| SMILES | ICc1cc(NCc2cccnc2)ncn1 |
| InChI | InChI=1S/C11H11IN4/c12-5-10-4-11(16-8-15-10)14-7-9-2-1-3-13-6-9/h1-4,6,8H,5,7H2,(H,14,15,16) |
| InChIKey | KHCQNXKSQAUNHH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.14 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|