C12H10N4 — CID 29036481
2-(pyridin-3-ylmethylamino)pyridine-4-carbonitrile (PubChem CID 29036481) has the molecular formula C12H10N4 and a molecular weight of 210.24 g/mol. Its IUPAC name is 2-(pyridin-3-ylmethylamino)pyridine-4-carbonitrile.
| Compound Name | 2-(pyridin-3-ylmethylamino)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 29036481 |
| Molecular Formula | C12H10N4 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2-(pyridin-3-ylmethylamino)pyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(NCc2cccnc2)c1 |
| InChI | InChI=1S/C12H10N4/c13-7-10-3-5-15-12(6-10)16-9-11-2-1-4-14-8-11/h1-6,8H,9H2,(H,15,16) |
| InChIKey | DKGVFIBCVVCYMD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |