C20H18N6 — CID 69183762
4-N,6-N-bis(pyridin-3-ylmethyl)-1,7-naphthyridine-4,6-diamine (PubChem CID 69183762) has the molecular formula C20H18N6 and a molecular weight of 342.41 g/mol. Its IUPAC name is 4-N,6-N-bis(pyridin-3-ylmethyl)-1,7-naphthyridine-4,6-diamine.
| Compound Name | 4-N,6-N-bis(pyridin-3-ylmethyl)-1,7-naphthyridine-4,6-diamine |
|---|---|
| PubChem CID | 69183762 |
| Molecular Formula | C20H18N6 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 4-N,6-N-bis(pyridin-3-ylmethyl)-1,7-naphthyridine-4,6-diamine |
| SMILES | c1cncc(CNc2cc3c(NCc4cccnc4)ccnc3cn2)c1 |
| InChI | InChI=1S/C20H18N6/c1-3-15(10-21-6-1)12-24-18-5-8-23-19-14-26-20(9-17(18)19)25-13-16-4-2-7-22-11-16/h1-11,14H,12-13H2,(H,23,24)(H,25,26) |
| InChIKey | KCNXHRCLRBPCLV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |