C13H12N4O2S — CID 24692112
4-[[(4-cyano-2-pyridinyl)amino]methyl]benzenesulfonamide (PubChem CID 24692112) has the molecular formula C13H12N4O2S and a molecular weight of 288.33 g/mol. Its IUPAC name is 4-[[(4-cyano-2-pyridinyl)amino]methyl]benzenesulfonamide.
| Compound Name | 4-[[(4-cyano-2-pyridinyl)amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24692112 |
| Molecular Formula | C13H12N4O2S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 4-[[(4-cyano-2-pyridinyl)amino]methyl]benzenesulfonamide |
| SMILES | N#Cc1ccnc(NCc2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C13H12N4O2S/c14-8-11-5-6-16-13(7-11)17-9-10-1-3-12(4-2-10)20(15,18)19/h1-7H,9H2,(H,16,17)(H2,15,18,19) |
| InChIKey | HAVZYVFZPFBCPM-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |