C14H14N4O2S — CID 133346456
6-[(4-cyanophenyl)methylamino]-N-methylpyridine-3-sulfonamide (PubChem CID 133346456) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is 6-[(4-cyanophenyl)methylamino]-N-methylpyridine-3-sulfonamide.
| Compound Name | 6-[(4-cyanophenyl)methylamino]-N-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 133346456 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 6-[(4-cyanophenyl)methylamino]-N-methylpyridine-3-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NCc2ccc(C#N)cc2)nc1 |
| InChI | InChI=1S/C14H14N4O2S/c1-16-21(19,20)13-6-7-14(18-10-13)17-9-12-4-2-11(8-15)3-5-12/h2-7,10,16H,9H2,1H3,(H,17,18) |
| InChIKey | KMXZQRVEOAVDMH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |