C14H11F2N3 — CID 133474689
6-[[4-(difluoromethyl)phenyl]methylamino]pyridine-3-carbonitrile (PubChem CID 133474689) has the molecular formula C14H11F2N3 and a molecular weight of 259.26 g/mol. Its IUPAC name is 6-[[4-(difluoromethyl)phenyl]methylamino]pyridine-3-carbonitrile.
| Compound Name | 6-[[4-(difluoromethyl)phenyl]methylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133474689 |
| Molecular Formula | C14H11F2N3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 6-[[4-(difluoromethyl)phenyl]methylamino]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(NCc2ccc(C(F)F)cc2)nc1 |
| InChI | InChI=1S/C14H11F2N3/c15-14(16)12-4-1-10(2-5-12)8-18-13-6-3-11(7-17)9-19-13/h1-6,9,14H,8H2,(H,18,19) |
| InChIKey | BUHSPXHLJMHTDQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |