C16H16FN3O — CID 94819702
6-[[(2R)-2-[(4-fluorophenyl)methyl]-3-hydroxypropyl]amino]pyridine-3-carbonitrile (PubChem CID 94819702) has the molecular formula C16H16FN3O and a molecular weight of 285.32 g/mol. Its IUPAC name is 6-[[(2R)-2-[(4-fluorophenyl)methyl]-3-hydroxypropyl]amino]pyridine-3-carbonitrile.
| Compound Name | 6-[[(2R)-2-[(4-fluorophenyl)methyl]-3-hydroxypropyl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 94819702 |
| Molecular Formula | C16H16FN3O |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 6-[[(2R)-2-[(4-fluorophenyl)methyl]-3-hydroxypropyl]amino]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(NC[C@H](CO)Cc2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C16H16FN3O/c17-15-4-1-12(2-5-15)7-14(11-21)10-20-16-6-3-13(8-18)9-19-16/h1-6,9,14,21H,7,10-11H2,(H,19,20)/t14-/m1/s1 |
| InChIKey | WQZGCATVSJIOSH-CQSZACIVSA-N |
| XLogP | 2.36 |
| TPSA | 68.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |