C8H12FN3O — CID 131123311
2-amino-3-[(5-fluoro-2-pyridinyl)amino]propan-1-ol (PubChem CID 131123311) has the molecular formula C8H12FN3O and a molecular weight of 185.20 g/mol. Its IUPAC name is 2-amino-3-[(5-fluoro-2-pyridinyl)amino]propan-1-ol.
| Compound Name | 2-amino-3-[(5-fluoro-2-pyridinyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 131123311 |
| Molecular Formula | C8H12FN3O |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 2-amino-3-[(5-fluoro-2-pyridinyl)amino]propan-1-ol |
| SMILES | NC(CO)CNc1ccc(F)cn1 |
| InChI | InChI=1S/C8H12FN3O/c9-6-1-2-8(11-3-6)12-4-7(10)5-13/h1-3,7,13H,4-5,10H2,(H,11,12) |
| InChIKey | AQCRUKOCRMCLKB-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |