C32H40N4O5S — CID 118031145
5-(3,3-dimethylbut-1-ynyl)-3-[(4-methylcyclohex-2-ene-1-carbonyl)-[4-(2-methyl-2-pyridin-2-yloxycarbonylhydrazinyl)cyclohexyl]amino]thiophene-2-carboxylic acid (PubChem CID 118031145) has the molecular formula C32H40N4O5S and a molecular weight of 592.76 g/mol. Its IUPAC name is 5-(3,3-dimethylbut-1-ynyl)-3-[(4-methylcyclohex-2-ene-1-carbonyl)-[4-(2-methyl-2-pyridin-2-yloxycarbonylhydrazinyl)cyclohexyl]amino]thiophene-2-carboxylic acid.
| Compound Name | 5-(3,3-dimethylbut-1-ynyl)-3-[(4-methylcyclohex-2-ene-1-carbonyl)-[4-(2-methyl-2-pyridin-2-yloxycarbonylhydrazinyl)cyclohexyl]amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 118031145 |
| Molecular Formula | C32H40N4O5S |
| Molecular Weight | 592.76 g/mol |
| Exact Mass | 592.27 |
| IUPAC Name | 5-(3,3-dimethylbut-1-ynyl)-3-[(4-methylcyclohex-2-ene-1-carbonyl)-[4-(2-methyl-2-pyridin-2-yloxycarbonylhydrazinyl)cyclohexyl]amino]thiophene-2-carboxylic acid |
| SMILES | CC1C=CC(C(=O)N(c2cc(C#CC(C)(C)C)sc2C(=O)O)C2CCC(NN(C)C(=O)Oc3ccccn3)CC2)CC1 |
| InChI | InChI=1S/C32H40N4O5S/c1-21-9-11-22(12-10-21)29(37)36(26-20-25(17-18-32(2,3)4)42-28(26)30(38)39)24-15-13-23(14-16-24)34-35(5)31(40)41-27-8-6-7-19-33-27/h6-9,11,19-24,34H,10,12-16H2,1-5H3,(H,38,39) |
| InChIKey | IBQHTEVUXHUDBN-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.76 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|