C12H13N9 — CID 118033843
N-ethyl-6-[2-(2H-tetrazol-5-ylamino)-4-pyridinyl]pyrimidin-4-amine (PubChem CID 118033843) has the molecular formula C12H13N9 and a molecular weight of 283.30 g/mol. Its IUPAC name is N-ethyl-6-[2-(2H-tetrazol-5-ylamino)-4-pyridinyl]pyrimidin-4-amine.
| Compound Name | N-ethyl-6-[2-(2H-tetrazol-5-ylamino)-4-pyridinyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 118033843 |
| Molecular Formula | C12H13N9 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | N-ethyl-6-[2-(2H-tetrazol-5-ylamino)-4-pyridinyl]pyrimidin-4-amine |
| SMILES | CCNc1cc(-c2ccnc(Nc3nn[nH]n3)c2)ncn1 |
| InChI | InChI=1S/C12H13N9/c1-2-13-10-6-9(15-7-16-10)8-3-4-14-11(5-8)17-12-18-20-21-19-12/h3-7H,2H2,1H3,(H,13,15,16)(H2,14,17,18,19,20,21) |
| InChIKey | IPZNHLYTWZQBIN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 117.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |