C20H21N9OS — CID 155440050
N-[[(1S)-1-(2-methoxyphenyl)ethyl]sulfanylmethyl]-6-[6-(2H-tetrazol-5-ylamino)-3-pyridinyl]pyrimidin-4-amine (PubChem CID 155440050) has the molecular formula C20H21N9OS and a molecular weight of 435.52 g/mol. Its IUPAC name is N-[[(1S)-1-(2-methoxyphenyl)ethyl]sulfanylmethyl]-6-[6-(2H-tetrazol-5-ylamino)-3-pyridinyl]pyrimidin-4-amine.
| Compound Name | N-[[(1S)-1-(2-methoxyphenyl)ethyl]sulfanylmethyl]-6-[6-(2H-tetrazol-5-ylamino)-3-pyridinyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155440050 |
| Molecular Formula | C20H21N9OS |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-[[(1S)-1-(2-methoxyphenyl)ethyl]sulfanylmethyl]-6-[6-(2H-tetrazol-5-ylamino)-3-pyridinyl]pyrimidin-4-amine |
| SMILES | COc1ccccc1[C@H](C)SCNc1cc(-c2ccc(Nc3nn[nH]n3)nc2)ncn1 |
| InChI | InChI=1S/C20H21N9OS/c1-13(15-5-3-4-6-17(15)30-2)31-12-24-19-9-16(22-11-23-19)14-7-8-18(21-10-14)25-20-26-28-29-27-20/h3-11,13H,12H2,1-2H3,(H,22,23,24)(H2,21,25,26,27,28,29)/t13-/m0/s1 |
| InChIKey | NMBWAAMNLCVZKW-ZDUSSCGKSA-N |
| XLogP | 3.67 |
| TPSA | 126.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|