C23H26N6O — CID 123442941
2-[[5-[6-[[3-(2-methoxyphenyl)-2-methylbutyl]amino]pyrimidin-4-yl]-2-pyridinyl]amino]acetonitrile (PubChem CID 123442941) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is 2-[[5-[6-[[3-(2-methoxyphenyl)-2-methylbutyl]amino]pyrimidin-4-yl]-2-pyridinyl]amino]acetonitrile.
| Compound Name | 2-[[5-[6-[[3-(2-methoxyphenyl)-2-methylbutyl]amino]pyrimidin-4-yl]-2-pyridinyl]amino]acetonitrile |
|---|---|
| PubChem CID | 123442941 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 2-[[5-[6-[[3-(2-methoxyphenyl)-2-methylbutyl]amino]pyrimidin-4-yl]-2-pyridinyl]amino]acetonitrile |
| SMILES | COc1ccccc1C(C)C(C)CNc1cc(-c2ccc(NCC#N)nc2)ncn1 |
| InChI | InChI=1S/C23H26N6O/c1-16(17(2)19-6-4-5-7-21(19)30-3)13-26-23-12-20(28-15-29-23)18-8-9-22(27-14-18)25-11-10-24/h4-9,12,14-17H,11,13H2,1-3H3,(H,25,27)(H,26,28,29) |
| InChIKey | HSLJHXGOENCPMH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|