C19H19FN4O — CID 73213572
6-(2-fluoro-4-pyridinyl)-N-[(2S)-2-(2-methoxyphenyl)propyl]pyrimidin-4-amine (PubChem CID 73213572) has the molecular formula C19H19FN4O and a molecular weight of 338.39 g/mol. Its IUPAC name is 6-(2-fluoro-4-pyridinyl)-N-[(2S)-2-(2-methoxyphenyl)propyl]pyrimidin-4-amine.
| Compound Name | 6-(2-fluoro-4-pyridinyl)-N-[(2S)-2-(2-methoxyphenyl)propyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 73213572 |
| Molecular Formula | C19H19FN4O |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 6-(2-fluoro-4-pyridinyl)-N-[(2S)-2-(2-methoxyphenyl)propyl]pyrimidin-4-amine |
| SMILES | COc1ccccc1[C@H](C)CNc1cc(-c2ccnc(F)c2)ncn1 |
| InChI | InChI=1S/C19H19FN4O/c1-13(15-5-3-4-6-17(15)25-2)11-22-19-10-16(23-12-24-19)14-7-8-21-18(20)9-14/h3-10,12-13H,11H2,1-2H3,(H,22,23,24)/t13-/m1/s1 |
| InChIKey | AZVDQWOEEHYUOK-CYBMUJFWSA-N |
| XLogP | 3.90 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|