C22H28N6O — CID 121440702
N'-[5-[6-[[(2S)-2-(2-methoxyphenyl)propyl]amino]pyrimidin-4-yl]-3-pyridinyl]-N-methylethane-1,2-diamine (PubChem CID 121440702) has the molecular formula C22H28N6O and a molecular weight of 392.51 g/mol. Its IUPAC name is N'-[5-[6-[[(2S)-2-(2-methoxyphenyl)propyl]amino]pyrimidin-4-yl]-3-pyridinyl]-N-methylethane-1,2-diamine.
| Compound Name | N'-[5-[6-[[(2S)-2-(2-methoxyphenyl)propyl]amino]pyrimidin-4-yl]-3-pyridinyl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 121440702 |
| Molecular Formula | C22H28N6O |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | N'-[5-[6-[[(2S)-2-(2-methoxyphenyl)propyl]amino]pyrimidin-4-yl]-3-pyridinyl]-N-methylethane-1,2-diamine |
| SMILES | CNCCNc1cncc(-c2cc(NC[C@@H](C)c3ccccc3OC)ncn2)c1 |
| InChI | InChI=1S/C22H28N6O/c1-16(19-6-4-5-7-21(19)29-3)12-26-22-11-20(27-15-28-22)17-10-18(14-24-13-17)25-9-8-23-2/h4-7,10-11,13-16,23,25H,8-9,12H2,1-3H3,(H,26,27,28)/t16-/m1/s1 |
| InChIKey | OJEMMSJDKWQPKW-MRXNPFEDSA-N |
| XLogP | 3.39 |
| TPSA | 83.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|