C22H18F3N5O — CID 118034583
5-[4-amino-7-(1,2,3,4-tetrahydronaphthalen-2-yl)imidazo[5,1-f][1,2,4]triazin-5-yl]-2-(trifluoromethyl)phenol (PubChem CID 118034583) has the molecular formula C22H18F3N5O and a molecular weight of 425.41 g/mol. Its IUPAC name is 5-[4-amino-7-(1,2,3,4-tetrahydronaphthalen-2-yl)imidazo[5,1-f][1,2,4]triazin-5-yl]-2-(trifluoromethyl)phenol.
| Compound Name | 5-[4-amino-7-(1,2,3,4-tetrahydronaphthalen-2-yl)imidazo[5,1-f][1,2,4]triazin-5-yl]-2-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 118034583 |
| Molecular Formula | C22H18F3N5O |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 5-[4-amino-7-(1,2,3,4-tetrahydronaphthalen-2-yl)imidazo[5,1-f][1,2,4]triazin-5-yl]-2-(trifluoromethyl)phenol |
| SMILES | Nc1ncnn2c(C3CCc4ccccc4C3)nc(-c3ccc(C(F)(F)F)c(O)c3)c12 |
| InChI | InChI=1S/C22H18F3N5O/c23-22(24,25)16-8-7-14(10-17(16)31)18-19-20(26)27-11-28-30(19)21(29-18)15-6-5-12-3-1-2-4-13(12)9-15/h1-4,7-8,10-11,15,31H,5-6,9H2,(H2,26,27,28) |
| InChIKey | YPFFGXROLKSKHJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |