C18H19N7O — CID 145011049
[4-[4-amino-5-(4-hydroxyphenyl)imidazo[5,1-f][1,2,4]triazin-7-yl]cyclohexyl]cyanamide (PubChem CID 145011049) has the molecular formula C18H19N7O and a molecular weight of 349.40 g/mol. Its IUPAC name is [4-[4-amino-5-(4-hydroxyphenyl)imidazo[5,1-f][1,2,4]triazin-7-yl]cyclohexyl]cyanamide.
| Compound Name | [4-[4-amino-5-(4-hydroxyphenyl)imidazo[5,1-f][1,2,4]triazin-7-yl]cyclohexyl]cyanamide |
|---|---|
| PubChem CID | 145011049 |
| Molecular Formula | C18H19N7O |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | [4-[4-amino-5-(4-hydroxyphenyl)imidazo[5,1-f][1,2,4]triazin-7-yl]cyclohexyl]cyanamide |
| SMILES | N#CNC1CCC(c2nc(-c3ccc(O)cc3)c3c(N)ncnn23)CC1 |
| InChI | InChI=1S/C18H19N7O/c19-9-21-13-5-1-12(2-6-13)18-24-15(11-3-7-14(26)8-4-11)16-17(20)22-10-23-25(16)18/h3-4,7-8,10,12-13,21,26H,1-2,5-6H2,(H2,20,22,23) |
| InChIKey | XWCAPCFZWCCPIA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 125.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|