C22H19N7O — CID 118861491
3-[4-amino-5-(4-phenoxyphenyl)imidazo[5,1-f][1,2,4]triazin-7-yl]pyrrolidine-1-carbonitrile (PubChem CID 118861491) has the molecular formula C22H19N7O and a molecular weight of 397.44 g/mol. Its IUPAC name is 3-[4-amino-5-(4-phenoxyphenyl)imidazo[5,1-f][1,2,4]triazin-7-yl]pyrrolidine-1-carbonitrile.
| Compound Name | 3-[4-amino-5-(4-phenoxyphenyl)imidazo[5,1-f][1,2,4]triazin-7-yl]pyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 118861491 |
| Molecular Formula | C22H19N7O |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 3-[4-amino-5-(4-phenoxyphenyl)imidazo[5,1-f][1,2,4]triazin-7-yl]pyrrolidine-1-carbonitrile |
| SMILES | N#CN1CCC(c2nc(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnn23)C1 |
| InChI | InChI=1S/C22H19N7O/c23-13-28-11-10-16(12-28)22-27-19(20-21(24)25-14-26-29(20)22)15-6-8-18(9-7-15)30-17-4-2-1-3-5-17/h1-9,14,16H,10-12H2,(H2,24,25,26) |
| InChIKey | FWPJUWZVFWRAFO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|