C24H27N5O — CID 70936936
7-heptyl-5-(4-phenoxyphenyl)imidazo[5,1-f][1,2,4]triazin-4-amine (PubChem CID 70936936) has the molecular formula C24H27N5O and a molecular weight of 401.51 g/mol. Its IUPAC name is 7-heptyl-5-(4-phenoxyphenyl)imidazo[5,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-heptyl-5-(4-phenoxyphenyl)imidazo[5,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 70936936 |
| Molecular Formula | C24H27N5O |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 7-heptyl-5-(4-phenoxyphenyl)imidazo[5,1-f][1,2,4]triazin-4-amine |
| SMILES | CCCCCCCc1nc(-c2ccc(Oc3ccccc3)cc2)c2c(N)ncnn12 |
| InChI | InChI=1S/C24H27N5O/c1-2-3-4-5-9-12-21-28-22(23-24(25)26-17-27-29(21)23)18-13-15-20(16-14-18)30-19-10-7-6-8-11-19/h6-8,10-11,13-17H,2-5,9,12H2,1H3,(H2,25,26,27) |
| InChIKey | HZPJRZPNPHYULP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|