C25H26N4O3 — CID 154658367
5-ethoxy-3-(oxan-4-yl)-1-(4-phenoxyphenyl)imidazo[1,5-a]pyrazin-8-amine (PubChem CID 154658367) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 5-ethoxy-3-(oxan-4-yl)-1-(4-phenoxyphenyl)imidazo[1,5-a]pyrazin-8-amine.
| Compound Name | 5-ethoxy-3-(oxan-4-yl)-1-(4-phenoxyphenyl)imidazo[1,5-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 154658367 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 5-ethoxy-3-(oxan-4-yl)-1-(4-phenoxyphenyl)imidazo[1,5-a]pyrazin-8-amine |
| SMILES | CCOc1cnc(N)c2c(-c3ccc(Oc4ccccc4)cc3)nc(C3CCOCC3)n12 |
| InChI | InChI=1S/C25H26N4O3/c1-2-31-21-16-27-24(26)23-22(28-25(29(21)23)18-12-14-30-15-13-18)17-8-10-20(11-9-17)32-19-6-4-3-5-7-19/h3-11,16,18H,2,12-15H2,1H3,(H2,26,27) |
| InChIKey | ILIROAJJZQATOU-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |