C18H15F6NOS — CID 118035681
2-ethylsulfanyl-N-methyl-4-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 118035681) has the molecular formula C18H15F6NOS and a molecular weight of 407.38 g/mol. Its IUPAC name is 2-ethylsulfanyl-N-methyl-4-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-ethylsulfanyl-N-methyl-4-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 118035681 |
| Molecular Formula | C18H15F6NOS |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 2-ethylsulfanyl-N-methyl-4-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCSc1cc(C(F)(F)F)ccc1C(=O)N(C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H15F6NOS/c1-3-27-15-10-12(18(22,23)24)6-9-14(15)16(26)25(2)13-7-4-11(5-8-13)17(19,20)21/h4-10H,3H2,1-2H3 |
| InChIKey | KMWUKYVFKIRMPK-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |