About 4-(aminomethyl)-N,3-dimethyl-N-[4-(trifluoromethyl)phenyl]benzamide;ethane
4-(aminomethyl)-N,3-dimethyl-N-[4-(trifluoromethyl)phenyl]benzamide;ethane (PubChem CID 143188892) has the molecular formula C21H29F3N2O
and a molecular weight of 382.47 g/mol. Its IUPAC name is 4-(aminomethyl)-N,3-dimethyl-N-[4-(trifluoromethyl)phenyl]benzamide;ethane.
Molecular Properties
| Compound Name | 4-(aminomethyl)-N,3-dimethyl-N-[4-(trifluoromethyl)phenyl]benzamide;ethane |
| PubChem CID | 143188892 |
| Molecular Formula | C21H29F3N2O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 4-(aminomethyl)-N,3-dimethyl-N-[4-(trifluoromethyl)phenyl]benzamide;ethane |
| SMILES | CC.CC.Cc1cc(C(=O)N(C)c2ccc(C(F)(F)F)cc2)ccc1CN |
| InChI | InChI=1S/C17H17F3N2O.2C2H6/c1-11-9-12(3-4-13(11)10-21)16(23)22(2)15-7-5-14(6-8-15)17(18,19)20;2*1-2/h3-9H,10,21H2,1-2H3;2*1-2H3 |
| InChIKey | OCLXBWXBQXSHPG-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(aminomethyl)-N,3-dimethyl-N-[4-(trifluoromethyl)phenyl]benzamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-N,3-dimethyl-N-[4-(trifluoromethyl)phenyl]benzamide;ethane?
The IUPAC name of 4-(aminomethyl)-N,3-dimethyl-N-[4-(trifluoromethyl)phenyl]benzamide;ethane (CID 143188892) is 4-(aminomethyl)-N,3-dimethyl-N-[4-(trifluoromethyl)phenyl]benzamide;ethane.
What is the SMILES notation for 4-(aminomethyl)-N,3-dimethyl-N-[4-(trifluoromethyl)phenyl]benzamide;ethane?
The canonical SMILES for 4-(aminomethyl)-N,3-dimethyl-N-[4-(trifluoromethyl)phenyl]benzamide;ethane is CC.CC.Cc1cc(C(=O)N(C)c2ccc(C(F)(F)F)cc2)ccc1CN.
What is the InChIKey of 4-(aminomethyl)-N,3-dimethyl-N-[4-(trifluoromethyl)phenyl]benzamide;ethane?
The InChIKey is OCLXBWXBQXSHPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F3N2O.2C2H6/c1-11-9-12(3-4-13(11)10-21)16(23)22(2)15-7-5-14(6-8-15)17(18,19)20;2*1-2/h3-9H,10,21H2,1-2H3;2*1-2H3.
What are the key properties of 4-(aminomethyl)-N,3-dimethyl-N-[4-(trifluoromethyl)phenyl]benzamide;ethane?
4-(aminomethyl)-N,3-dimethyl-N-[4-(trifluoromethyl)phenyl]benzamide;ethane has a molecular weight of 382.47 g/mol, XLogP of 5.80, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-N,3-dimethyl-N-[4-(trifluoromethyl)phenyl]benzamide;ethane is sourced from PubChem (CID 143188892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).