C20H20N2O2 — CID 57470787
4-(aminomethyl)-N-[2-(furan-2-yl)phenyl]-N,3-dimethylbenzamide (PubChem CID 57470787) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[2-(furan-2-yl)phenyl]-N,3-dimethylbenzamide.
| Compound Name | 4-(aminomethyl)-N-[2-(furan-2-yl)phenyl]-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 57470787 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 4-(aminomethyl)-N-[2-(furan-2-yl)phenyl]-N,3-dimethylbenzamide |
| SMILES | Cc1cc(C(=O)N(C)c2ccccc2-c2ccco2)ccc1CN |
| InChI | InChI=1S/C20H20N2O2/c1-14-12-15(9-10-16(14)13-21)20(23)22(2)18-7-4-3-6-17(18)19-8-5-11-24-19/h3-12H,13,21H2,1-2H3 |
| InChIKey | UUJJXVBUFOQQHC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |