C24H33N7O4 — CID 118036356
N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-7-(dimethoxymethyl)-6-[1-(methylamino)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 118036356) has the molecular formula C24H33N7O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-7-(dimethoxymethyl)-6-[1-(methylamino)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-7-(dimethoxymethyl)-6-[1-(methylamino)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 118036356 |
| Molecular Formula | C24H33N7O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-7-(dimethoxymethyl)-6-[1-(methylamino)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | CNC(C)c1cc2c(nc1C(OC)OC)N(C(=O)Nc1cc(NCCOC)c(C#N)cn1)CCC2 |
| InChI | InChI=1S/C24H33N7O4/c1-15(26-2)18-11-16-7-6-9-31(22(16)30-21(18)23(34-4)35-5)24(32)29-20-12-19(27-8-10-33-3)17(13-25)14-28-20/h11-12,14-15,23,26H,6-10H2,1-5H3,(H2,27,28,29,32) |
| InChIKey | VMAGUXXTJAERDM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 133.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|