C24H28N8O4 — CID 118036788
N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-7-(dimethoxymethyl)-6-imidazol-1-yl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 118036788) has the molecular formula C24H28N8O4 and a molecular weight of 492.54 g/mol. Its IUPAC name is N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-7-(dimethoxymethyl)-6-imidazol-1-yl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-7-(dimethoxymethyl)-6-imidazol-1-yl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 118036788 |
| Molecular Formula | C24H28N8O4 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-7-(dimethoxymethyl)-6-imidazol-1-yl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | COCCNc1cc(NC(=O)N2CCCc3cc(-n4ccnc4)c(C(OC)OC)nc32)ncc1C#N |
| InChI | InChI=1S/C24H28N8O4/c1-34-10-7-27-18-12-20(28-14-17(18)13-25)29-24(33)32-8-4-5-16-11-19(31-9-6-26-15-31)21(30-22(16)32)23(35-2)36-3/h6,9,11-12,14-15,23H,4-5,7-8,10H2,1-3H3,(H2,27,28,29,33) |
| InChIKey | WOICEMBALLTYBX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 139.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|