C14H23N3O2 — CID 118038593
1-[2-(dimethoxymethyl)-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl]-N-methylethanamine (PubChem CID 118038593) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 1-[2-(dimethoxymethyl)-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl]-N-methylethanamine.
| Compound Name | 1-[2-(dimethoxymethyl)-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 118038593 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 1-[2-(dimethoxymethyl)-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl]-N-methylethanamine |
| SMILES | CNC(C)c1cc2c(nc1C(OC)OC)NCCC2 |
| InChI | InChI=1S/C14H23N3O2/c1-9(15-2)11-8-10-6-5-7-16-13(10)17-12(11)14(18-3)19-4/h8-9,14-15H,5-7H2,1-4H3,(H,16,17) |
| InChIKey | BWEPPAFACJEYIQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|