C10H14N2O — CID 133059709
6-ethoxy-1,2,3,4-tetrahydro-1,8-naphthyridine (PubChem CID 133059709) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 6-ethoxy-1,2,3,4-tetrahydro-1,8-naphthyridine.
| Compound Name | 6-ethoxy-1,2,3,4-tetrahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 133059709 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 6-ethoxy-1,2,3,4-tetrahydro-1,8-naphthyridine |
| SMILES | CCOc1cnc2c(c1)CCCN2 |
| InChI | InChI=1S/C10H14N2O/c1-2-13-9-6-8-4-3-5-11-10(8)12-7-9/h6-7H,2-5H2,1H3,(H,11,12) |
| InChIKey | CWUKKXMFEBERTF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |