About 3-ethoxy-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine
3-ethoxy-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine (PubChem CID 71302980) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 3-ethoxy-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | 3-ethoxy-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine |
| PubChem CID | 71302980 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 3-ethoxy-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine |
| SMILES | CCOc1cnc2c(c1)CNC2 |
| InChI | InChI=1S/C9H12N2O/c1-2-12-8-3-7-4-10-6-9(7)11-5-8/h3,5,10H,2,4,6H2,1H3 |
| InChIKey | AQRXSVVGSRSETQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethoxy-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine?
The IUPAC name of 3-ethoxy-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine (CID 71302980) is 3-ethoxy-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine.
What is the SMILES notation for 3-ethoxy-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine?
The canonical SMILES for 3-ethoxy-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine is CCOc1cnc2c(c1)CNC2.
What is the InChIKey of 3-ethoxy-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine?
The InChIKey is AQRXSVVGSRSETQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-2-12-8-3-7-4-10-6-9(7)11-5-8/h3,5,10H,2,4,6H2,1H3.
What are the key properties of 3-ethoxy-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine?
3-ethoxy-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine has a molecular weight of 164.21 g/mol, XLogP of 1.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine is sourced from PubChem (CID 71302980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).