C17H25N3O4 — CID 118036291
(5S)-4-[[2-(dimethoxymethyl)-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl]methyl]-5-methylmorpholin-3-one (PubChem CID 118036291) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is (5S)-4-[[2-(dimethoxymethyl)-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl]methyl]-5-methylmorpholin-3-one.
| Compound Name | (5S)-4-[[2-(dimethoxymethyl)-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl]methyl]-5-methylmorpholin-3-one |
|---|---|
| PubChem CID | 118036291 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | (5S)-4-[[2-(dimethoxymethyl)-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl]methyl]-5-methylmorpholin-3-one |
| SMILES | COC(OC)c1nc2c(cc1CN1C(=O)COC[C@@H]1C)CCCN2 |
| InChI | InChI=1S/C17H25N3O4/c1-11-9-24-10-14(21)20(11)8-13-7-12-5-4-6-18-16(12)19-15(13)17(22-2)23-3/h7,11,17H,4-6,8-10H2,1-3H3,(H,18,19)/t11-/m0/s1 |
| InChIKey | TXAZPWALNLAUCS-NSHDSACASA-N |
| XLogP | 1.48 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|