C16H26N2 — CID 142013132
ethane;8-ethyl-1,2,3,4,6,7,8,9-octahydrobenzo[b][1,8]naphthyridine (PubChem CID 142013132) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is ethane;8-ethyl-1,2,3,4,6,7,8,9-octahydrobenzo[b][1,8]naphthyridine.
| Compound Name | ethane;8-ethyl-1,2,3,4,6,7,8,9-octahydrobenzo[b][1,8]naphthyridine |
|---|---|
| PubChem CID | 142013132 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | ethane;8-ethyl-1,2,3,4,6,7,8,9-octahydrobenzo[b][1,8]naphthyridine |
| SMILES | CC.CCC1CCc2cc3c(nc2C1)NCCC3 |
| InChI | InChI=1S/C14H20N2.C2H6/c1-2-10-5-6-11-9-12-4-3-7-15-14(12)16-13(11)8-10;1-2/h9-10H,2-8H2,1H3,(H,15,16);1-2H3 |
| InChIKey | VBEJMFQHTYPDQI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |