C10H11N3O4 — CID 118038729
[5-cyano-4-(2-methoxyethoxy)-2-pyridinyl]carbamic acid (PubChem CID 118038729) has the molecular formula C10H11N3O4 and a molecular weight of 237.22 g/mol. Its IUPAC name is [5-cyano-4-(2-methoxyethoxy)-2-pyridinyl]carbamic acid.
| Compound Name | [5-cyano-4-(2-methoxyethoxy)-2-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 118038729 |
| Molecular Formula | C10H11N3O4 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | [5-cyano-4-(2-methoxyethoxy)-2-pyridinyl]carbamic acid |
| SMILES | COCCOc1cc(NC(=O)O)ncc1C#N |
| InChI | InChI=1S/C10H11N3O4/c1-16-2-3-17-8-4-9(13-10(14)15)12-6-7(8)5-11/h4,6H,2-3H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | MGEBBVDAVOXYCX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|