C21H24FN3O2 — CID 118040774
2-(4-cyclobutyl-1,4-diazepan-1-yl)-6-(4-fluorophenoxy)pyridine-3-carbaldehyde (PubChem CID 118040774) has the molecular formula C21H24FN3O2 and a molecular weight of 369.44 g/mol. Its IUPAC name is 2-(4-cyclobutyl-1,4-diazepan-1-yl)-6-(4-fluorophenoxy)pyridine-3-carbaldehyde.
| Compound Name | 2-(4-cyclobutyl-1,4-diazepan-1-yl)-6-(4-fluorophenoxy)pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 118040774 |
| Molecular Formula | C21H24FN3O2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 2-(4-cyclobutyl-1,4-diazepan-1-yl)-6-(4-fluorophenoxy)pyridine-3-carbaldehyde |
| SMILES | O=Cc1ccc(Oc2ccc(F)cc2)nc1N1CCCN(C2CCC2)CC1 |
| InChI | InChI=1S/C21H24FN3O2/c22-17-6-8-19(9-7-17)27-20-10-5-16(15-26)21(23-20)25-12-2-11-24(13-14-25)18-3-1-4-18/h5-10,15,18H,1-4,11-14H2 |
| InChIKey | PQBCVGXIOQTFPL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|