C22H20FN3O — CID 174522072
7-(3-cyclobutyl-2H-imidazol-1-yl)-8-fluoro-2-phenoxyquinoline (PubChem CID 174522072) has the molecular formula C22H20FN3O and a molecular weight of 361.42 g/mol. Its IUPAC name is 7-(3-cyclobutyl-2H-imidazol-1-yl)-8-fluoro-2-phenoxyquinoline.
| Compound Name | 7-(3-cyclobutyl-2H-imidazol-1-yl)-8-fluoro-2-phenoxyquinoline |
|---|---|
| PubChem CID | 174522072 |
| Molecular Formula | C22H20FN3O |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 7-(3-cyclobutyl-2H-imidazol-1-yl)-8-fluoro-2-phenoxyquinoline |
| SMILES | Fc1c(N2C=CN(C3CCC3)C2)ccc2ccc(Oc3ccccc3)nc12 |
| InChI | InChI=1S/C22H20FN3O/c23-21-19(26-14-13-25(15-26)17-5-4-6-17)11-9-16-10-12-20(24-22(16)21)27-18-7-2-1-3-8-18/h1-3,7-14,17H,4-6,15H2 |
| InChIKey | HCIAOEBLNKWBEB-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |