C20H25N3O3 — CID 167858499
tert-butyl 2-[(4-phenoxypyrimidin-2-yl)amino]cyclopentane-1-carboxylate (PubChem CID 167858499) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is tert-butyl 2-[(4-phenoxypyrimidin-2-yl)amino]cyclopentane-1-carboxylate.
| Compound Name | tert-butyl 2-[(4-phenoxypyrimidin-2-yl)amino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 167858499 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | tert-butyl 2-[(4-phenoxypyrimidin-2-yl)amino]cyclopentane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCCC1Nc1nccc(Oc2ccccc2)n1 |
| InChI | InChI=1S/C20H25N3O3/c1-20(2,3)26-18(24)15-10-7-11-16(15)22-19-21-13-12-17(23-19)25-14-8-5-4-6-9-14/h4-6,8-9,12-13,15-16H,7,10-11H2,1-3H3,(H,21,22,23) |
| InChIKey | FLUMYPIFJBUUCS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |