C28H32ClN3O3 — CID 170621993
tert-butyl (3R)-3-[[2-chloro-3-(4-phenoxyanilino)-4-pyridinyl]amino]cyclohexane-1-carboxylate (PubChem CID 170621993) has the molecular formula C28H32ClN3O3 and a molecular weight of 494.04 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[2-chloro-3-(4-phenoxyanilino)-4-pyridinyl]amino]cyclohexane-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[2-chloro-3-(4-phenoxyanilino)-4-pyridinyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 170621993 |
| Molecular Formula | C28H32ClN3O3 |
| Molecular Weight | 494.04 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | tert-butyl (3R)-3-[[2-chloro-3-(4-phenoxyanilino)-4-pyridinyl]amino]cyclohexane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCC[C@@H](Nc2ccnc(Cl)c2Nc2ccc(Oc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C28H32ClN3O3/c1-28(2,3)35-27(33)19-8-7-9-21(18-19)31-24-16-17-30-26(29)25(24)32-20-12-14-23(15-13-20)34-22-10-5-4-6-11-22/h4-6,10-17,19,21,32H,7-9,18H2,1-3H3,(H,30,31)/t19?,21-/m1/s1 |
| InChIKey | BRTSAIGUIYCXHO-VGAJERRHSA-N |
| XLogP | 7.58 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.04 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|