C17H19N3OS2 — CID 167881536
N-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]dithiin-5-yl)-4-phenoxypyrimidin-2-amine (PubChem CID 167881536) has the molecular formula C17H19N3OS2 and a molecular weight of 345.49 g/mol. Its IUPAC name is N-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]dithiin-5-yl)-4-phenoxypyrimidin-2-amine.
| Compound Name | N-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]dithiin-5-yl)-4-phenoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 167881536 |
| Molecular Formula | C17H19N3OS2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | N-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]dithiin-5-yl)-4-phenoxypyrimidin-2-amine |
| SMILES | c1ccc(Oc2ccnc(NC3CCC4SCCSC34)n2)cc1 |
| InChI | InChI=1S/C17H19N3OS2/c1-2-4-12(5-3-1)21-15-8-9-18-17(20-15)19-13-6-7-14-16(13)23-11-10-22-14/h1-5,8-9,13-14,16H,6-7,10-11H2,(H,18,19,20) |
| InChIKey | SIQYFGMXCCQNIE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |