C18H19N5O — CID 167914287
N-[(3-cyclobutyl-1H-pyrazol-5-yl)methyl]-4-phenoxypyrimidin-2-amine (PubChem CID 167914287) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is N-[(3-cyclobutyl-1H-pyrazol-5-yl)methyl]-4-phenoxypyrimidin-2-amine.
| Compound Name | N-[(3-cyclobutyl-1H-pyrazol-5-yl)methyl]-4-phenoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 167914287 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | N-[(3-cyclobutyl-1H-pyrazol-5-yl)methyl]-4-phenoxypyrimidin-2-amine |
| SMILES | c1ccc(Oc2ccnc(NCc3cc(C4CCC4)n[nH]3)n2)cc1 |
| InChI | InChI=1S/C18H19N5O/c1-2-7-15(8-3-1)24-17-9-10-19-18(21-17)20-12-14-11-16(23-22-14)13-5-4-6-13/h1-3,7-11,13H,4-6,12H2,(H,22,23)(H,19,20,21) |
| InChIKey | COOWPQILEJNYSC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |