About 2-phenoxy-7-(trifluoromethyl)-1,8-naphthyridine
2-phenoxy-7-(trifluoromethyl)-1,8-naphthyridine (PubChem CID 141387441) has the molecular formula C15H9F3N2O
and a molecular weight of 290.24 g/mol. Its IUPAC name is 2-phenoxy-7-(trifluoromethyl)-1,8-naphthyridine.
Molecular Properties
| Compound Name | 2-phenoxy-7-(trifluoromethyl)-1,8-naphthyridine |
| PubChem CID | 141387441 |
| Molecular Formula | C15H9F3N2O |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 2-phenoxy-7-(trifluoromethyl)-1,8-naphthyridine |
| SMILES | FC(F)(F)c1ccc2ccc(Oc3ccccc3)nc2n1 |
| InChI | InChI=1S/C15H9F3N2O/c16-15(17,18)12-8-6-10-7-9-13(20-14(10)19-12)21-11-4-2-1-3-5-11/h1-9H |
| InChIKey | IUFQVGPUKMBGCK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenoxy-7-(trifluoromethyl)-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxy-7-(trifluoromethyl)-1,8-naphthyridine?
The IUPAC name of 2-phenoxy-7-(trifluoromethyl)-1,8-naphthyridine (CID 141387441) is 2-phenoxy-7-(trifluoromethyl)-1,8-naphthyridine.
What is the SMILES notation for 2-phenoxy-7-(trifluoromethyl)-1,8-naphthyridine?
The canonical SMILES for 2-phenoxy-7-(trifluoromethyl)-1,8-naphthyridine is FC(F)(F)c1ccc2ccc(Oc3ccccc3)nc2n1.
What is the InChIKey of 2-phenoxy-7-(trifluoromethyl)-1,8-naphthyridine?
The InChIKey is IUFQVGPUKMBGCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9F3N2O/c16-15(17,18)12-8-6-10-7-9-13(20-14(10)19-12)21-11-4-2-1-3-5-11/h1-9H.
What are the key properties of 2-phenoxy-7-(trifluoromethyl)-1,8-naphthyridine?
2-phenoxy-7-(trifluoromethyl)-1,8-naphthyridine has a molecular weight of 290.24 g/mol, XLogP of 4.44, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxy-7-(trifluoromethyl)-1,8-naphthyridine is sourced from PubChem (CID 141387441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).