C15H9F3N2O — CID 141387441
2-phenoxy-7-(trifluoromethyl)-1,8-naphthyridine (PubChem CID 141387441) has the molecular formula C15H9F3N2O and a molecular weight of 290.24 g/mol. Its IUPAC name is 2-phenoxy-7-(trifluoromethyl)-1,8-naphthyridine.
| Compound Name | 2-phenoxy-7-(trifluoromethyl)-1,8-naphthyridine |
|---|---|
| PubChem CID | 141387441 |
| Molecular Formula | C15H9F3N2O |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 2-phenoxy-7-(trifluoromethyl)-1,8-naphthyridine |
| SMILES | FC(F)(F)c1ccc2ccc(Oc3ccccc3)nc2n1 |
| InChI | InChI=1S/C15H9F3N2O/c16-15(17,18)12-8-6-10-7-9-13(20-14(10)19-12)21-11-4-2-1-3-5-11/h1-9H |
| InChIKey | IUFQVGPUKMBGCK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |