C13H9F4NO2 — CID 87974377
2-phenoxy-6-(1,1,2,2-tetrafluoroethoxy)pyridine (PubChem CID 87974377) has the molecular formula C13H9F4NO2 and a molecular weight of 287.21 g/mol. Its IUPAC name is 2-phenoxy-6-(1,1,2,2-tetrafluoroethoxy)pyridine.
| Compound Name | 2-phenoxy-6-(1,1,2,2-tetrafluoroethoxy)pyridine |
|---|---|
| PubChem CID | 87974377 |
| Molecular Formula | C13H9F4NO2 |
| Molecular Weight | 287.21 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2-phenoxy-6-(1,1,2,2-tetrafluoroethoxy)pyridine |
| SMILES | FC(F)C(F)(F)Oc1cccc(Oc2ccccc2)n1 |
| InChI | InChI=1S/C13H9F4NO2/c14-12(15)13(16,17)20-11-8-4-7-10(18-11)19-9-5-2-1-3-6-9/h1-8,12H |
| InChIKey | LXOMJNCBSZZXEH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.21 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|