C14H20N2O2 — CID 118041348
N-[(3-methylbutanoylamino)methyl]octa-3,5-diynamide (PubChem CID 118041348) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is N-[(3-methylbutanoylamino)methyl]octa-3,5-diynamide.
| Compound Name | N-[(3-methylbutanoylamino)methyl]octa-3,5-diynamide |
|---|---|
| PubChem CID | 118041348 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | N-[(3-methylbutanoylamino)methyl]octa-3,5-diynamide |
| SMILES | CCC#CC#CCC(=O)NCNC(=O)CC(C)C |
| InChI | InChI=1S/C14H20N2O2/c1-4-5-6-7-8-9-13(17)15-11-16-14(18)10-12(2)3/h12H,4,9-11H2,1-3H3,(H,15,17)(H,16,18) |
| InChIKey | ISXOBGCZIBCDCZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|